C32H37N3O7 — CID 59052652
(3aR,5R,6S,6aR)-5-[(1R)-1-[[2-(azidomethyl)phenyl]methoxy]-2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 59052652) has the molecular formula C32H37N3O7 and a molecular weight of 575.66 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(1R)-1-[[2-(azidomethyl)phenyl]methoxy]-2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(1R)-1-[[2-(azidomethyl)phenyl]methoxy]-2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 59052652 |
| Molecular Formula | C32H37N3O7 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(1R)-1-[[2-(azidomethyl)phenyl]methoxy]-2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COc1ccc(COC[C@@H](OCc2ccccc2CN=[N+]=[N-])[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H37N3O7/c1-32(2)41-30-29(39-19-22-9-5-4-6-10-22)28(40-31(30)42-32)27(21-37-18-23-13-15-26(36-3)16-14-23)38-20-25-12-8-7-11-24(25)17-34-35-33/h4-16,27-31H,17-21H2,1-3H3/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | VEEYNTKIKCHHEC-PXPWAULYSA-N |
| XLogP | 6.07 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|