C31H36O11S2 — CID 124587561
[(2S)-2-[(3aR,5S,6R,6aS)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate (PubChem CID 124587561) has the molecular formula C31H36O11S2 and a molecular weight of 648.75 g/mol. Its IUPAC name is [(2S)-2-[(3aR,5S,6R,6aS)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(3aR,5S,6R,6aS)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 124587561 |
| Molecular Formula | C31H36O11S2 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | [(2S)-2-[(3aR,5S,6R,6aS)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CO[C@H]2[C@@H]3OC(C)(C)O[C@H]3O[C@@H]2[C@H](COS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H36O11S2/c1-20-6-14-24(15-7-20)43(32,33)38-19-26(42-44(34,35)25-16-8-21(2)9-17-25)27-28(29-30(39-27)41-31(3,4)40-29)37-18-22-10-12-23(36-5)13-11-22/h6-17,26-30H,18-19H2,1-5H3/t26-,27+,28+,29-,30+/m0/s1 |
| InChIKey | IVRDTKNGXBFBGW-NAGJOQLLSA-N |
| XLogP | 4.25 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|