C24H29N3O8S — CID 23258730
[(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 23258730) has the molecular formula C24H29N3O8S and a molecular weight of 519.58 g/mol. Its IUPAC name is [(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23258730 |
| Molecular Formula | C24H29N3O8S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | [(2R,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](N=[N+]=[N-])[C@H](O)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N3O8S/c1-15-9-11-17(12-10-15)36(29,30)32-14-18(26-27-25)19(28)20-21(31-13-16-7-5-4-6-8-16)22-23(33-20)35-24(2,3)34-22/h4-12,18-23,28H,13-14H2,1-3H3/t18-,19+,20-,21+,22-,23-/m1/s1 |
| InChIKey | MNFAKYBMAWNSPL-PYYGYTMVSA-N |
| XLogP | 3.20 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|