C25H40O9SSi — CID 10896877
[(2R)-2-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(Z)-prop-1-enoxy]ethyl] 4-[tert-butyl(dimethyl)silyl]oxybenzenesulfonate (PubChem CID 10896877) has the molecular formula C25H40O9SSi and a molecular weight of 544.74 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(Z)-prop-1-enoxy]ethyl] 4-[tert-butyl(dimethyl)silyl]oxybenzenesulfonate.
| Compound Name | [(2R)-2-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(Z)-prop-1-enoxy]ethyl] 4-[tert-butyl(dimethyl)silyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 10896877 |
| Molecular Formula | C25H40O9SSi |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(Z)-prop-1-enoxy]ethyl] 4-[tert-butyl(dimethyl)silyl]oxybenzenesulfonate |
| SMILES | C/C=C\O[C@H](COS(=O)(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C25H40O9SSi/c1-10-15-29-19(20-21(28-7)22-23(31-20)33-25(5,6)32-22)16-30-35(26,27)18-13-11-17(12-14-18)34-36(8,9)24(2,3)4/h10-15,19-23H,16H2,1-9H3/b15-10-/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | FAIPDNPPZIPJDS-WTSUQHTPSA-N |
| XLogP | 4.59 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|