C17H22O8S — CID 14754690
[2-[(3aS,5S,6S,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 14754690) has the molecular formula C17H22O8S and a molecular weight of 386.42 g/mol. Its IUPAC name is [2-[(3aS,5S,6S,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(3aS,5S,6S,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14754690 |
| Molecular Formula | C17H22O8S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [2-[(3aS,5S,6S,6aS)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2O[C@@H]1C(=O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O8S/c1-10-5-7-11(8-6-10)26(19,20)22-9-12(18)13-14(21-4)15-16(23-13)25-17(2,3)24-15/h5-8,13-16H,9H2,1-4H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | NQAFZJAEJLVOGQ-WCVJEAGWSA-N |
| XLogP | 1.16 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|