C20H30O8S — CID 122597583
2-[2-[[(3aR,5R,6aS)-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propan-2-yloxy]ethyl 4-methylbenzenesulfonate (PubChem CID 122597583) has the molecular formula C20H30O8S and a molecular weight of 430.52 g/mol. Its IUPAC name is 2-[2-[[(3aR,5R,6aS)-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propan-2-yloxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[[(3aR,5R,6aS)-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propan-2-yloxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122597583 |
| Molecular Formula | C20H30O8S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[2-[[(3aR,5R,6aS)-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propan-2-yloxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC(C)(C)OC2[C@@H](C)O[C@@H]3OC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C20H30O8S/c1-13-7-9-15(10-8-13)29(21,22)24-12-11-23-19(3,4)26-16-14(2)25-18-17(16)27-20(5,6)28-18/h7-10,14,16-18H,11-12H2,1-6H3/t14-,16?,17+,18-/m1/s1 |
| InChIKey | NUJAAHVXMBXNOS-HMONXNITSA-N |
| XLogP | 2.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|