C20H32O5 — CID 89257971
(3R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-6-methylnon-8-en-3-ol (PubChem CID 89257971) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (3R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-6-methylnon-8-en-3-ol.
| Compound Name | (3R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-6-methylnon-8-en-3-ol |
|---|---|
| PubChem CID | 89257971 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-6-methylnon-8-en-3-ol |
| SMILES | C=CCC(C)C(C[C@H](O)CCOCc1ccc(OC)cc1)OCOC |
| InChI | InChI=1S/C20H32O5/c1-5-6-16(2)20(25-15-22-3)13-18(21)11-12-24-14-17-7-9-19(23-4)10-8-17/h5,7-10,16,18,20-21H,1,6,11-15H2,2-4H3/t16?,18-,20?/m1/s1 |
| InChIKey | PYNJOJAWJCODMB-KGXSXCIVSA-N |
| XLogP | 3.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|