C44H64O8Si — CID 10747636
(3R,4R,5S,6S,9S,10S,11R)-12-[tert-butyl(diphenyl)silyl]oxy-4,10-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9,11-tetramethyldodec-7-yn-6-ol (PubChem CID 10747636) has the molecular formula C44H64O8Si and a molecular weight of 749.07 g/mol. Its IUPAC name is (3R,4R,5S,6S,9S,10S,11R)-12-[tert-butyl(diphenyl)silyl]oxy-4,10-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9,11-tetramethyldodec-7-yn-6-ol.
| Compound Name | (3R,4R,5S,6S,9S,10S,11R)-12-[tert-butyl(diphenyl)silyl]oxy-4,10-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9,11-tetramethyldodec-7-yn-6-ol |
|---|---|
| PubChem CID | 10747636 |
| Molecular Formula | C44H64O8Si |
| Molecular Weight | 749.07 g/mol |
| Exact Mass | 748.44 |
| IUPAC Name | (3R,4R,5S,6S,9S,10S,11R)-12-[tert-butyl(diphenyl)silyl]oxy-4,10-bis(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-3,5,9,11-tetramethyldodec-7-yn-6-ol |
| SMILES | COCO[C@H]([C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)C#C[C@@H](O)[C@H](C)[C@H](OCOC)[C@H](C)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C44H64O8Si/c1-33(21-26-41(45)36(4)43(51-32-47-9)34(2)27-28-49-30-37-22-24-38(48-10)25-23-37)42(50-31-46-8)35(3)29-52-53(44(5,6)7,39-17-13-11-14-18-39)40-19-15-12-16-20-40/h11-20,22-25,33-36,41-43,45H,27-32H2,1-10H3/t33-,34+,35+,36-,41+,42-,43+/m0/s1 |
| InChIKey | QSJUBWSZJZJVBX-HEGWWBBYSA-N |
| XLogP | 7.07 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.07 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|