C42H54O7Si — CID 134866735
(1R,2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-3-methyl-5-phenylmethoxypentan-1-ol (PubChem CID 134866735) has the molecular formula C42H54O7Si and a molecular weight of 698.97 g/mol. Its IUPAC name is (1R,2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-3-methyl-5-phenylmethoxypentan-1-ol.
| Compound Name | (1R,2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-3-methyl-5-phenylmethoxypentan-1-ol |
|---|---|
| PubChem CID | 134866735 |
| Molecular Formula | C42H54O7Si |
| Molecular Weight | 698.97 g/mol |
| Exact Mass | 698.36 |
| IUPAC Name | (1R,2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5R)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-3-methyl-5-phenylmethoxypentan-1-ol |
| SMILES | COc1ccc(CO[C@@H]2CC([C@@H](O)[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](C)CCOCc3ccccc3)O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C42H54O7Si/c1-31(25-26-46-29-32-15-9-6-10-16-32)41(49-50(42(2,3)4,35-17-11-7-12-18-35)36-19-13-8-14-20-36)40(44)38-27-37(39(28-43)48-38)47-30-33-21-23-34(45-5)24-22-33/h6-24,31,37-41,43-44H,25-30H2,1-5H3/t31-,37-,38?,39-,40-,41-/m1/s1 |
| InChIKey | JTZCUIIQXFBXIS-CKUJIQOVSA-N |
| XLogP | 6.28 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.97 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|