C30H36O4Si — CID 11283212
tert-butyl-[[(2S,3S)-3-[3-[(4-methoxyphenyl)methoxy]prop-1-en-2-yl]oxiran-2-yl]methoxy]-diphenylsilane (PubChem CID 11283212) has the molecular formula C30H36O4Si and a molecular weight of 488.70 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-3-[3-[(4-methoxyphenyl)methoxy]prop-1-en-2-yl]oxiran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3S)-3-[3-[(4-methoxyphenyl)methoxy]prop-1-en-2-yl]oxiran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11283212 |
| Molecular Formula | C30H36O4Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | tert-butyl-[[(2S,3S)-3-[3-[(4-methoxyphenyl)methoxy]prop-1-en-2-yl]oxiran-2-yl]methoxy]-diphenylsilane |
| SMILES | C=C(COCc1ccc(OC)cc1)[C@@H]1O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H36O4Si/c1-23(20-32-21-24-16-18-25(31-5)19-17-24)29-28(34-29)22-33-35(30(2,3)4,26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-19,28-29H,1,20-22H2,2-5H3/t28-,29-/m0/s1 |
| InChIKey | IYEIWZDQNTXQSD-VMPREFPWSA-N |
| XLogP | 5.11 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|