C52H66O5Si2 — CID 11274421
(1S,7S,7aR)-7,7a-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxymethyl]-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 11274421) has the molecular formula C52H66O5Si2 and a molecular weight of 827.27 g/mol. Its IUPAC name is (1S,7S,7aR)-7,7a-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxymethyl]-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1S,7S,7aR)-7,7a-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxymethyl]-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 11274421 |
| Molecular Formula | C52H66O5Si2 |
| Molecular Weight | 827.27 g/mol |
| Exact Mass | 826.44 |
| IUPAC Name | (1S,7S,7aR)-7,7a-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxymethyl]-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | COc1ccc(COC[C@H]2CCC3(O)CCC[C@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@@]23CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C52H66O5Si2/c1-49(2,3)58(45-22-12-8-13-23-45,46-24-14-9-15-25-46)56-39-42-21-20-35-51(53)36-34-43(38-55-37-41-30-32-44(54-7)33-31-41)52(42,51)40-57-59(50(4,5)6,47-26-16-10-17-27-47)48-28-18-11-19-29-48/h8-19,22-33,42-43,53H,20-21,34-40H2,1-7H3/t42-,43-,51?,52+/m1/s1 |
| InChIKey | GAYOKUUXMJFHGY-IQVBYDFNSA-N |
| XLogP | 9.29 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.27 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|