C35H43FO4Si — CID 91047673
(8R,9R)-9-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-1-[(4-methoxyphenyl)methoxy]-8-methyldec-6-en-3-yn-5-ol (PubChem CID 91047673) has the molecular formula C35H43FO4Si and a molecular weight of 574.81 g/mol. Its IUPAC name is (8R,9R)-9-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-1-[(4-methoxyphenyl)methoxy]-8-methyldec-6-en-3-yn-5-ol.
| Compound Name | (8R,9R)-9-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-1-[(4-methoxyphenyl)methoxy]-8-methyldec-6-en-3-yn-5-ol |
|---|---|
| PubChem CID | 91047673 |
| Molecular Formula | C35H43FO4Si |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | (8R,9R)-9-[tert-butyl(diphenyl)silyl]oxy-6-fluoro-1-[(4-methoxyphenyl)methoxy]-8-methyldec-6-en-3-yn-5-ol |
| SMILES | COc1ccc(COCCC#CC(O)C(F)=C[C@@H](C)[C@@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H43FO4Si/c1-27(25-33(36)34(37)19-13-14-24-39-26-29-20-22-30(38-6)23-21-29)28(2)40-41(35(3,4)5,31-15-9-7-10-16-31)32-17-11-8-12-18-32/h7-12,15-18,20-23,25,27-28,34,37H,14,24,26H2,1-6H3/t27-,28-,34?/m1/s1 |
| InChIKey | REDASBRMCKOAPZ-VNPSQQOISA-N |
| XLogP | 6.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|