C48H56O6Si — CID 11983685
(3S,7S,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-3,7-bis(phenylmethoxy)dec-5-yn-4-ol (PubChem CID 11983685) has the molecular formula C48H56O6Si and a molecular weight of 757.06 g/mol. Its IUPAC name is (3S,7S,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-3,7-bis(phenylmethoxy)dec-5-yn-4-ol.
| Compound Name | (3S,7S,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-3,7-bis(phenylmethoxy)dec-5-yn-4-ol |
|---|---|
| PubChem CID | 11983685 |
| Molecular Formula | C48H56O6Si |
| Molecular Weight | 757.06 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | (3S,7S,9R)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]-3,7-bis(phenylmethoxy)dec-5-yn-4-ol |
| SMILES | COc1ccc(CO[C@H](C)C[C@@H](C#CC(O)[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C48H56O6Si/c1-38(51-35-41-26-28-42(50-5)29-27-41)34-43(52-36-39-18-10-6-11-19-39)30-31-46(49)47(53-37-40-20-12-7-13-21-40)32-33-54-55(48(2,3)4,44-22-14-8-15-23-44)45-24-16-9-17-25-45/h6-29,38,43,46-47,49H,32-37H2,1-5H3/t38-,43-,46?,47+/m1/s1 |
| InChIKey | SMQPPETWQPEREC-XPNIVRFQSA-N |
| XLogP | 8.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.06 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|