C45H60O7Si — CID 10580858
tert-butyl-[(11S)-11-(2,2-dimethoxyethyl)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-4,12-dimethyltridec-12-en-2,7-diyn-6-yl]oxy-diphenylsilane (PubChem CID 10580858) has the molecular formula C45H60O7Si and a molecular weight of 741.05 g/mol. Its IUPAC name is tert-butyl-[(11S)-11-(2,2-dimethoxyethyl)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-4,12-dimethyltridec-12-en-2,7-diyn-6-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(11S)-11-(2,2-dimethoxyethyl)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-4,12-dimethyltridec-12-en-2,7-diyn-6-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10580858 |
| Molecular Formula | C45H60O7Si |
| Molecular Weight | 741.05 g/mol |
| Exact Mass | 740.41 |
| IUPAC Name | tert-butyl-[(11S)-11-(2,2-dimethoxyethyl)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-4,12-dimethyltridec-12-en-2,7-diyn-6-yl]oxy-diphenylsilane |
| SMILES | C=C(C)C(CCC#CC(CC(C)(C#CCOCc1ccc(OC)cc1)OCOC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(OC)OC |
| InChI | InChI=1S/C45H60O7Si/c1-36(2)38(32-43(48-9)49-10)20-17-18-21-40(52-53(44(3,4)5,41-22-13-11-14-23-41)42-24-15-12-16-25-42)33-45(6,51-35-46-7)30-19-31-50-34-37-26-28-39(47-8)29-27-37/h11-16,22-29,38,40,43H,1,17,20,31-35H2,2-10H3 |
| InChIKey | BNJNDSKXYSNUIX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.05 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|