C32H42O4Si — CID 11731013
(4S,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-5-methylhept-1-en-4-ol (PubChem CID 11731013) has the molecular formula C32H42O4Si and a molecular weight of 518.77 g/mol. Its IUPAC name is (4S,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-5-methylhept-1-en-4-ol.
| Compound Name | (4S,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-5-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 11731013 |
| Molecular Formula | C32H42O4Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (4S,5R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-5-methylhept-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@@H](C)[C@@H](COCc1ccc(OC)cc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H42O4Si/c1-7-14-30(33)25(2)31(24-35-23-26-19-21-27(34-6)22-20-26)36-37(32(3,4)5,28-15-10-8-11-16-28)29-17-12-9-13-18-29/h7-13,15-22,25,30-31,33H,1,14,23-24H2,2-6H3/t25-,30+,31-/m1/s1 |
| InChIKey | VCQQQRWENHCVTF-SDDUWZMOSA-N |
| XLogP | 5.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|