C34H44O3Si — CID 71726043
tert-butyl-[(3Z,5S)-2-ethyl-5-[(4-methoxyphenyl)methoxy]octa-3,7-dienoxy]-diphenylsilane (PubChem CID 71726043) has the molecular formula C34H44O3Si and a molecular weight of 528.81 g/mol. Its IUPAC name is tert-butyl-[(3Z,5S)-2-ethyl-5-[(4-methoxyphenyl)methoxy]octa-3,7-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3Z,5S)-2-ethyl-5-[(4-methoxyphenyl)methoxy]octa-3,7-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71726043 |
| Molecular Formula | C34H44O3Si |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | tert-butyl-[(3Z,5S)-2-ethyl-5-[(4-methoxyphenyl)methoxy]octa-3,7-dienoxy]-diphenylsilane |
| SMILES | C=CC[C@@H](/C=C\C(CC)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C34H44O3Si/c1-7-15-31(36-26-29-21-23-30(35-6)24-22-29)25-20-28(8-2)27-37-38(34(3,4)5,32-16-11-9-12-17-32)33-18-13-10-14-19-33/h7,9-14,16-25,28,31H,1,8,15,26-27H2,2-6H3/b25-20-/t28?,31-/m0/s1 |
| InChIKey | WWQIIQHOSJGMDE-KKVVVOLHSA-N |
| XLogP | 7.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|