C27H37BrO2Si — CID 135028667
(4R,5Z,7R)-2-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylnona-1,5-dien-4-ol (PubChem CID 135028667) has the molecular formula C27H37BrO2Si and a molecular weight of 501.58 g/mol. Its IUPAC name is (4R,5Z,7R)-2-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylnona-1,5-dien-4-ol.
| Compound Name | (4R,5Z,7R)-2-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylnona-1,5-dien-4-ol |
|---|---|
| PubChem CID | 135028667 |
| Molecular Formula | C27H37BrO2Si |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (4R,5Z,7R)-2-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylnona-1,5-dien-4-ol |
| SMILES | C=C(Br)C[C@@H](O)/C(C)=C\[C@@H](CC)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H37BrO2Si/c1-7-23(18-21(2)26(29)19-22(3)28)20-30-31(27(4,5)6,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-18,23,26,29H,3,7,19-20H2,1-2,4-6H3/b21-18-/t23-,26-/m1/s1 |
| InChIKey | OFDWZPHTXOKFSL-HTJMYADVSA-N |
| XLogP | 6.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|