C57H61NO6Si — CID 10463397
tert-butyl-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)-diphenylmethyl]aziridin-2-yl]-2,3-bis[(4-methoxyphenyl)methoxy]propoxy]-diphenylsilane (PubChem CID 10463397) has the molecular formula C57H61NO6Si and a molecular weight of 884.20 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)-diphenylmethyl]aziridin-2-yl]-2,3-bis[(4-methoxyphenyl)methoxy]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)-diphenylmethyl]aziridin-2-yl]-2,3-bis[(4-methoxyphenyl)methoxy]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10463397 |
| Molecular Formula | C57H61NO6Si |
| Molecular Weight | 884.20 g/mol |
| Exact Mass | 883.43 |
| IUPAC Name | tert-butyl-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)-diphenylmethyl]aziridin-2-yl]-2,3-bis[(4-methoxyphenyl)methoxy]propoxy]-diphenylsilane |
| SMILES | COc1ccc(CO[C@@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccc(OC)cc2)[C@@H]2CN2C(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C57H61NO6Si/c1-56(2,3)65(51-23-15-9-16-24-51,52-25-17-10-18-26-52)64-42-54(62-40-43-27-33-48(59-4)34-28-43)55(63-41-44-29-35-49(60-5)36-30-44)53-39-58(53)57(45-19-11-7-12-20-45,46-21-13-8-14-22-46)47-31-37-50(61-6)38-32-47/h7-38,53-55H,39-42H2,1-6H3/t53-,54+,55+,58?/m0/s1 |
| InChIKey | XUHGXKILPUDYOJ-IZHSIKLGSA-N |
| XLogP | 10.44 |
| TPSA | 58.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.20 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|