C38H50O5Si — CID 102361173
(5R)-5-[(1R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-6-methyl-2-methylideneheptyl]oxolan-2-one (PubChem CID 102361173) has the molecular formula C38H50O5Si and a molecular weight of 614.90 g/mol. Its IUPAC name is (5R)-5-[(1R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-6-methyl-2-methylideneheptyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-6-methyl-2-methylideneheptyl]oxolan-2-one |
|---|---|
| PubChem CID | 102361173 |
| Molecular Formula | C38H50O5Si |
| Molecular Weight | 614.90 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | (5R)-5-[(1R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-6-methyl-2-methylideneheptyl]oxolan-2-one |
| SMILES | C=C(CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C)[C@@H](OCc1ccc(OC)cc1)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C38H50O5Si/c1-28(2)31(27-42-44(38(4,5)6,33-14-10-8-11-15-33)34-16-12-9-13-17-34)21-18-29(3)37(35-24-25-36(39)43-35)41-26-30-19-22-32(40-7)23-20-30/h8-17,19-20,22-23,28,31,35,37H,3,18,21,24-27H2,1-2,4-7H3/t31-,35+,37+/m0/s1 |
| InChIKey | AAKVGRHCSUZJAS-FCWLVIOWSA-N |
| XLogP | 7.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.90 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|