C38H41NO6Si — CID 102377727
(3aS,6S,6aR)-6-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]ethyl]-3a-methyl-2-phenyl-6,6a-dihydrofuro[3,4-d][1,3]oxazol-4-one (PubChem CID 102377727) has the molecular formula C38H41NO6Si and a molecular weight of 635.83 g/mol. Its IUPAC name is (3aS,6S,6aR)-6-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]ethyl]-3a-methyl-2-phenyl-6,6a-dihydrofuro[3,4-d][1,3]oxazol-4-one.
| Compound Name | (3aS,6S,6aR)-6-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]ethyl]-3a-methyl-2-phenyl-6,6a-dihydrofuro[3,4-d][1,3]oxazol-4-one |
|---|---|
| PubChem CID | 102377727 |
| Molecular Formula | C38H41NO6Si |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | (3aS,6S,6aR)-6-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]ethyl]-3a-methyl-2-phenyl-6,6a-dihydrofuro[3,4-d][1,3]oxazol-4-one |
| SMILES | COc1ccc(CO[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(=O)[C@@]3(C)N=C(c4ccccc4)O[C@@H]23)cc1 |
| InChI | InChI=1S/C38H41NO6Si/c1-37(2,3)46(30-17-11-7-12-18-30,31-19-13-8-14-20-31)43-26-32(42-25-27-21-23-29(41-5)24-22-27)33-34-38(4,36(40)44-33)39-35(45-34)28-15-9-6-10-16-28/h6-24,32-34H,25-26H2,1-5H3/t32-,33+,34-,38-/m0/s1 |
| InChIKey | BFMWPXGMUUITDH-OXWPWTPBSA-N |
| XLogP | 5.69 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|