C35H44O5Si — CID 177428846
(2R,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-[(4-methoxyphenyl)methoxy]-5-methyl-2,5,6,7-tetrahydrooxocin-8-one (PubChem CID 177428846) has the molecular formula C35H44O5Si and a molecular weight of 572.82 g/mol. Its IUPAC name is (2R,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-[(4-methoxyphenyl)methoxy]-5-methyl-2,5,6,7-tetrahydrooxocin-8-one.
| Compound Name | (2R,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-[(4-methoxyphenyl)methoxy]-5-methyl-2,5,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 177428846 |
| Molecular Formula | C35H44O5Si |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | (2R,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-[(4-methoxyphenyl)methoxy]-5-methyl-2,5,6,7-tetrahydrooxocin-8-one |
| SMILES | COc1ccc(CO[C@@H]2CC(=O)O[C@@H]([C@H](C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=C[C@@H]2C)cc1 |
| InChI | InChI=1S/C35H44O5Si/c1-26-17-22-32(40-34(36)23-33(26)38-25-28-18-20-29(37-6)21-19-28)27(2)24-39-41(35(3,4)5,30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-22,26-27,32-33H,23-25H2,1-6H3/t26-,27+,32+,33+/m0/s1 |
| InChIKey | FPBFWUSBJIDTOD-GVVHOTPJSA-N |
| XLogP | 6.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|