C29H36N2O3Si — CID 57089287
(3S,4R)-3-amino-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 57089287) has the molecular formula C29H36N2O3Si and a molecular weight of 488.70 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-amino-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 57089287 |
| Molecular Formula | C29H36N2O3Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (3S,4R)-3-amino-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](N)[C@H]2[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H36N2O3Si/c1-21(27-26(30)28(32)31(27)22-16-18-23(33-5)19-17-22)20-34-35(29(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,21,26-27H,20,30H2,1-5H3/t21-,26+,27-/m1/s1 |
| InChIKey | WKRSOQPGKZVRII-COFKYPDJSA-N |
| XLogP | 3.95 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|