C27H31NO4Si — CID 142794272
3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 142794272) has the molecular formula C27H31NO4Si and a molecular weight of 461.63 g/mol. Its IUPAC name is 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142794272 |
| Molecular Formula | C27H31NO4Si |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C2CN(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H31NO4Si/c1-27(2,3)33(23-11-7-5-8-12-23,24-13-9-6-10-14-24)31-20-28-19-25(32-26(28)29)21-15-17-22(30-4)18-16-21/h5-18,25H,19-20H2,1-4H3 |
| InChIKey | UOELCYAWPQRNHI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|