C34H40O6Si — CID 52937203
(2R,4aR,6S,9Z,10aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(4-methoxyphenyl)-4,4a,8,10a-tetrahydro-[1,3]dioxino[5,4-b]oxocin-7-one (PubChem CID 52937203) has the molecular formula C34H40O6Si and a molecular weight of 572.77 g/mol. Its IUPAC name is (2R,4aR,6S,9Z,10aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(4-methoxyphenyl)-4,4a,8,10a-tetrahydro-[1,3]dioxino[5,4-b]oxocin-7-one.
| Compound Name | (2R,4aR,6S,9Z,10aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(4-methoxyphenyl)-4,4a,8,10a-tetrahydro-[1,3]dioxino[5,4-b]oxocin-7-one |
|---|---|
| PubChem CID | 52937203 |
| Molecular Formula | C34H40O6Si |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (2R,4aR,6S,9Z,10aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(4-methoxyphenyl)-4,4a,8,10a-tetrahydro-[1,3]dioxino[5,4-b]oxocin-7-one |
| SMILES | COc1ccc([C@@H]2OC[C@H]3O[C@@H](CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C(=O)C/C=C\[C@@H]3O2)cc1 |
| InChI | InChI=1S/C34H40O6Si/c1-34(2,3)41(27-12-7-5-8-13-27,28-14-9-6-10-15-28)38-23-22-30-29(35)16-11-17-31-32(39-30)24-37-33(40-31)25-18-20-26(36-4)21-19-25/h5-15,17-21,30-33H,16,22-24H2,1-4H3/b17-11-/t30-,31-,32+,33+/m0/s1 |
| InChIKey | YKUWNLUFVISTFD-QYBMZWCMSA-N |
| XLogP | 5.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|