C29H38O4Si — CID 24756174
(4aS,6R,7Z,10aR)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,4,4a,6,10,10a-hexahydro-2H-pyrano[3,2-b]oxocin-9-one (PubChem CID 24756174) has the molecular formula C29H38O4Si and a molecular weight of 478.71 g/mol. Its IUPAC name is (4aS,6R,7Z,10aR)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,4,4a,6,10,10a-hexahydro-2H-pyrano[3,2-b]oxocin-9-one.
| Compound Name | (4aS,6R,7Z,10aR)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,4,4a,6,10,10a-hexahydro-2H-pyrano[3,2-b]oxocin-9-one |
|---|---|
| PubChem CID | 24756174 |
| Molecular Formula | C29H38O4Si |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (4aS,6R,7Z,10aR)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,4,4a,6,10,10a-hexahydro-2H-pyrano[3,2-b]oxocin-9-one |
| SMILES | CC(C)(C)[Si](OCCC[C@@H]1/C=C\C(=O)C[C@H]2OCCC[C@@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H38O4Si/c1-29(2,3)34(25-13-6-4-7-14-25,26-15-8-5-9-16-26)32-21-10-12-24-19-18-23(30)22-28-27(33-24)17-11-20-31-28/h4-9,13-16,18-19,24,27-28H,10-12,17,20-22H2,1-3H3/b19-18-/t24-,27+,28-/m1/s1 |
| InChIKey | FIUVBPQDGLPKLN-VWGVWHRRSA-N |
| XLogP | 4.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|