C24H33BrHgO2Si — CID 101368247
CID 101368247 (PubChem CID 101368247) has the molecular formula C24H33BrHgO2Si and a molecular weight of 662.11 g/mol.
| Compound Name | CID 101368247 |
|---|---|
| PubChem CID | 101368247 |
| Molecular Formula | C24H33BrHgO2Si |
| Molecular Weight | 662.11 g/mol |
| Exact Mass | 662.11 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](OCCC[CH][C@@H]1CCCO1)(c1ccccc1)c1ccccc1.[Br-].[Hg+] |
| InChI | InChI=1S/C24H33O2Si.BrH.Hg/c1-24(2,3)27(22-15-6-4-7-16-22,23-17-8-5-9-18-23)26-20-11-10-13-21-14-12-19-25-21;;/h4-9,13,15-18,21H,10-12,14,19-20H2,1-3H3;1H;/q;;+1/p-1/t21-;;/m1../s1 |
| InChIKey | VEHICYBXHKJPAD-GHVWMZMZSA-M |
| XLogP | 1.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.11 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|