C25H36O3Si — CID 23240942
tert-butyl-[3-[(2S,3S)-3-methoxyoxan-2-yl]propoxy]-diphenylsilane (PubChem CID 23240942) has the molecular formula C25H36O3Si and a molecular weight of 412.65 g/mol. Its IUPAC name is tert-butyl-[3-[(2S,3S)-3-methoxyoxan-2-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[(2S,3S)-3-methoxyoxan-2-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 23240942 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | tert-butyl-[3-[(2S,3S)-3-methoxyoxan-2-yl]propoxy]-diphenylsilane |
| SMILES | CO[C@H]1CCCO[C@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O3Si/c1-25(2,3)29(21-13-7-5-8-14-21,22-15-9-6-10-16-22)28-20-12-18-24-23(26-4)17-11-19-27-24/h5-10,13-16,23-24H,11-12,17-20H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | KFMMYSNYEVRSBW-ZEQRLZLVSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|