C25H34O4Si — CID 102426988
(2R,3S)-2-[[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]oxan-3-ol (PubChem CID 102426988) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (2R,3S)-2-[[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]oxan-3-ol.
| Compound Name | (2R,3S)-2-[[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]oxan-3-ol |
|---|---|
| PubChem CID | 102426988 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2R,3S)-2-[[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]oxan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H]1C[C@H]1OCCC[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34O4Si/c1-25(2,3)30(19-11-6-4-7-12-19,20-13-8-5-9-14-20)28-18-24-23(29-24)17-22-21(26)15-10-16-27-22/h4-9,11-14,21-24,26H,10,15-18H2,1-3H3/t21-,22+,23+,24+/m0/s1 |
| InChIKey | OJIRGROPNBUKIU-OLKYXYMISA-N |
| XLogP | 3.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|