C31H42O5Si — CID 11083332
(2R,3S)-2-[(7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-5-methoxy-2-methylideneoct-3-ynyl]oxan-3-ol (PubChem CID 11083332) has the molecular formula C31H42O5Si and a molecular weight of 522.76 g/mol. Its IUPAC name is (2R,3S)-2-[(7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-5-methoxy-2-methylideneoct-3-ynyl]oxan-3-ol.
| Compound Name | (2R,3S)-2-[(7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-5-methoxy-2-methylideneoct-3-ynyl]oxan-3-ol |
|---|---|
| PubChem CID | 11083332 |
| Molecular Formula | C31H42O5Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | (2R,3S)-2-[(7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-5-methoxy-2-methylideneoct-3-ynyl]oxan-3-ol |
| SMILES | C=C(C#CC(C[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC)C[C@H]1OCCC[C@@H]1O |
| InChI | InChI=1S/C31H42O5Si/c1-24(21-30-29(33)17-12-20-35-30)18-19-26(34-5)22-25(32)23-36-37(31(2,3)4,27-13-8-6-9-14-27)28-15-10-7-11-16-28/h6-11,13-16,25-26,29-30,32-33H,1,12,17,20-23H2,2-5H3/t25-,26?,29-,30+/m0/s1 |
| InChIKey | DZONCBGURDTTIZ-JDMUDCHHSA-N |
| XLogP | 3.82 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|