C33H42O4Si — CID 10482138
(1S,2S)-2-[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]oxy-1-(4-methylphenyl)but-3-en-1-ol (PubChem CID 10482138) has the molecular formula C33H42O4Si and a molecular weight of 530.78 g/mol. Its IUPAC name is (1S,2S)-2-[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]oxy-1-(4-methylphenyl)but-3-en-1-ol.
| Compound Name | (1S,2S)-2-[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]oxy-1-(4-methylphenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 10482138 |
| Molecular Formula | C33H42O4Si |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (1S,2S)-2-[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]oxy-1-(4-methylphenyl)but-3-en-1-ol |
| SMILES | C=C[C@H](O[C@H]1CCCO[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H42O4Si/c1-6-29(32(34)26-21-19-25(2)20-22-26)37-30-18-13-23-35-31(30)24-36-38(33(3,4)5,27-14-9-7-10-15-27)28-16-11-8-12-17-28/h6-12,14-17,19-22,29-32,34H,1,13,18,23-24H2,2-5H3/t29-,30-,31+,32-/m0/s1 |
| InChIKey | UHYNDHJZCBVNGS-IHZBLBIESA-N |
| XLogP | 5.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|