C28H38O5Si — CID 135010313
(1S)-1-[(3aR,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]ethanol (PubChem CID 135010313) has the molecular formula C28H38O5Si and a molecular weight of 482.69 g/mol. Its IUPAC name is (1S)-1-[(3aR,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]ethanol.
| Compound Name | (1S)-1-[(3aR,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 135010313 |
| Molecular Formula | C28H38O5Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (1S)-1-[(3aR,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]ethanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H]1C[C@H](O)C1C[C@H]2OCCC[C@@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H38O5Si/c1-28(2,3)34(20-11-6-4-7-12-20,21-13-8-5-9-14-21)31-19-27-26(33-27)17-22(29)24-18-25-23(32-24)15-10-16-30-25/h4-9,11-14,22-27,29H,10,15-19H2,1-3H3/t22-,23-,24?,25+,26+,27+/m0/s1 |
| InChIKey | SOVFACBUANFQPL-KZCASMSVSA-N |
| XLogP | 3.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|