C26H36O4Si — CID 10646782
(2S,3S,4aR,8aR)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol (PubChem CID 10646782) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is (2S,3S,4aR,8aR)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol.
| Compound Name | (2S,3S,4aR,8aR)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol |
|---|---|
| PubChem CID | 10646782 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | (2S,3S,4aR,8aR)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1O[C@@H]2CCCO[C@@H]2C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36O4Si/c1-26(2,3)31(20-11-6-4-7-12-20,21-13-8-5-9-14-21)29-18-16-23-22(27)19-25-24(30-23)15-10-17-28-25/h4-9,11-14,22-25,27H,10,15-19H2,1-3H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | GHMHUUOCJBLSIW-CXSMSNRLSA-N |
| XLogP | 3.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|