C30H36O4Si — CID 11799218
(2R)-2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2-hydroxy-1-phenylethanone (PubChem CID 11799218) has the molecular formula C30H36O4Si and a molecular weight of 488.70 g/mol. Its IUPAC name is (2R)-2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2-hydroxy-1-phenylethanone.
| Compound Name | (2R)-2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 11799218 |
| Molecular Formula | C30H36O4Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (2R)-2-[(2R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-yl]-2-hydroxy-1-phenylethanone |
| SMILES | CC(C)(C)[Si](OC[C@H]1CCC[C@H]([C@@H](O)C(=O)c2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36O4Si/c1-30(2,3)35(25-17-9-5-10-18-25,26-19-11-6-12-20-26)33-22-24-16-13-21-27(34-24)29(32)28(31)23-14-7-4-8-15-23/h4-12,14-15,17-20,24,27,29,32H,13,16,21-22H2,1-3H3/t24-,27-,29-/m1/s1 |
| InChIKey | GPENIHLDNLRKFU-WOEHHYBBSA-N |
| XLogP | 4.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|