C59H72O8SSi2 — CID 11083606
(4S)-2-(benzenesulfonyl)-1,4-bis[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-4-phenylmethoxybutan-1-ol (PubChem CID 11083606) has the molecular formula C59H72O8SSi2 and a molecular weight of 997.46 g/mol. Its IUPAC name is (4S)-2-(benzenesulfonyl)-1,4-bis[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-4-phenylmethoxybutan-1-ol.
| Compound Name | (4S)-2-(benzenesulfonyl)-1,4-bis[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-4-phenylmethoxybutan-1-ol |
|---|---|
| PubChem CID | 11083606 |
| Molecular Formula | C59H72O8SSi2 |
| Molecular Weight | 997.46 g/mol |
| Exact Mass | 996.45 |
| IUPAC Name | (4S)-2-(benzenesulfonyl)-1,4-bis[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]-4-phenylmethoxybutan-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H](C(O)C(C[C@H](OCc2ccccc2)[C@@H]2CC[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)S(=O)(=O)c2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C59H72O8SSi2/c1-58(2,3)69(49-29-17-9-18-30-49,50-31-19-10-20-32-50)64-43-46-37-39-53(66-46)55(63-42-45-25-13-7-14-26-45)41-56(68(61,62)48-27-15-8-16-28-48)57(60)54-40-38-47(67-54)44-65-70(59(4,5)6,51-33-21-11-22-34-51)52-35-23-12-24-36-52/h7-36,46-47,53-57,60H,37-44H2,1-6H3/t46-,47-,53-,54-,55-,56?,57?/m0/s1 |
| InChIKey | FAIPCYPEZVEFDJ-TUFCGOEVSA-N |
| XLogP | 9.41 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.46 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|