C31H38O5Si — CID 71171700
[(3R,7S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxepan-2-yl] benzoate (PubChem CID 71171700) has the molecular formula C31H38O5Si and a molecular weight of 518.73 g/mol. Its IUPAC name is [(3R,7S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxepan-2-yl] benzoate.
| Compound Name | [(3R,7S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxepan-2-yl] benzoate |
|---|---|
| PubChem CID | 71171700 |
| Molecular Formula | C31H38O5Si |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [(3R,7S)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxepan-2-yl] benzoate |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC[C@@](C)(O)C(OC(=O)c2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O5Si/c1-30(2,3)37(26-18-10-6-11-19-26,27-20-12-7-13-21-27)34-23-25-17-14-22-31(4,33)29(35-25)36-28(32)24-15-8-5-9-16-24/h5-13,15-16,18-21,25,29,33H,14,17,22-23H2,1-4H3/t25-,29?,31+/m0/s1 |
| InChIKey | VOQWFIOOUDZCJQ-SBYPTKLRSA-N |
| XLogP | 5.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|