C40H58O3Si — CID 145367352
tert-butyl-[19-(oxan-2-yloxy)nonadeca-5,14-diynoxy]-diphenylsilane (PubChem CID 145367352) has the molecular formula C40H58O3Si and a molecular weight of 614.99 g/mol. Its IUPAC name is tert-butyl-[19-(oxan-2-yloxy)nonadeca-5,14-diynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[19-(oxan-2-yloxy)nonadeca-5,14-diynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 145367352 |
| Molecular Formula | C40H58O3Si |
| Molecular Weight | 614.99 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | tert-butyl-[19-(oxan-2-yloxy)nonadeca-5,14-diynoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCC#CCCCCCCCC#CCCCCOC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H58O3Si/c1-40(2,3)44(37-29-21-19-22-30-37,38-31-23-20-24-32-38)43-36-27-18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-26-34-41-39-33-25-28-35-42-39/h19-24,29-32,39H,4-10,15-18,25-28,33-36H2,1-3H3 |
| InChIKey | AZJUJPRFYZUINT-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.99 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|