C36H58O4Si — CID 175678466
(3S,4S,6S,8R,10S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecan-3-ol (PubChem CID 175678466) has the molecular formula C36H58O4Si and a molecular weight of 582.94 g/mol. Its IUPAC name is (3S,4S,6S,8R,10S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecan-3-ol.
| Compound Name | (3S,4S,6S,8R,10S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecan-3-ol |
|---|---|
| PubChem CID | 175678466 |
| Molecular Formula | C36H58O4Si |
| Molecular Weight | 582.94 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | (3S,4S,6S,8R,10S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undecan-3-ol |
| SMILES | C[C@@H](C[C@H](C)COC1CCCCO1)C[C@H](C)C[C@H](C)[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H58O4Si/c1-28(25-30(3)27-39-35-20-14-15-22-38-35)24-29(2)26-31(4)34(37)21-23-40-41(36(5,6)7,32-16-10-8-11-17-32)33-18-12-9-13-19-33/h8-13,16-19,28-31,34-35,37H,14-15,20-27H2,1-7H3/t28-,29+,30+,31+,34+,35?/m1/s1 |
| InChIKey | OHJFUFDJLVHDEV-GSJWCBSRSA-N |
| XLogP | 7.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.94 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|