C26H37NO3Si — CID 169181483
(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[1-(oxan-2-yloxy)cyclopropyl]ethanamine (PubChem CID 169181483) has the molecular formula C26H37NO3Si and a molecular weight of 439.67 g/mol. Its IUPAC name is (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[1-(oxan-2-yloxy)cyclopropyl]ethanamine.
| Compound Name | (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[1-(oxan-2-yloxy)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 169181483 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[1-(oxan-2-yloxy)cyclopropyl]ethanamine |
| SMILES | CC(C)(C)[Si](OC[C@@H](N)C1(OC2CCCCO2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H37NO3Si/c1-25(2,3)31(21-12-6-4-7-13-21,22-14-8-5-9-15-22)29-20-23(27)26(17-18-26)30-24-16-10-11-19-28-24/h4-9,12-15,23-24H,10-11,16-20,27H2,1-3H3/t23-,24?/m1/s1 |
| InChIKey | BLZWNBJAAOMRIF-MIHMCVIASA-N |
| XLogP | 3.97 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|