C28H40O6Si — CID 100984372
methyl (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-methyl-3-(oxan-2-yloxy)pentanoate (PubChem CID 100984372) has the molecular formula C28H40O6Si and a molecular weight of 500.71 g/mol. Its IUPAC name is methyl (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-methyl-3-(oxan-2-yloxy)pentanoate.
| Compound Name | methyl (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-methyl-3-(oxan-2-yloxy)pentanoate |
|---|---|
| PubChem CID | 100984372 |
| Molecular Formula | C28H40O6Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | methyl (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-methyl-3-(oxan-2-yloxy)pentanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](OC1CCCCO1)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O6Si/c1-21(26(25(29)27(30)31-5)34-24-18-12-13-19-32-24)20-33-35(28(2,3)4,22-14-8-6-9-15-22)23-16-10-7-11-17-23/h6-11,14-17,21,24-26,29H,12-13,18-20H2,1-5H3/t21-,24?,25+,26-/m1/s1 |
| InChIKey | ABLAUFNMGKANMF-RPOLDZMGSA-N |
| XLogP | 3.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|