C30H40O3Si — CID 53392022
6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-cyclohexyl-2,3-dihydropyran-4-one (PubChem CID 53392022) has the molecular formula C30H40O3Si and a molecular weight of 476.73 g/mol. Its IUPAC name is 6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-cyclohexyl-2,3-dihydropyran-4-one.
| Compound Name | 6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-cyclohexyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 53392022 |
| Molecular Formula | C30H40O3Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-cyclohexyl-2,3-dihydropyran-4-one |
| SMILES | CC(C)(C)[Si](OCCCC1=CC(=O)CC(C2CCCCC2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H40O3Si/c1-30(2,3)34(27-17-9-5-10-18-27,28-19-11-6-12-20-28)32-21-13-16-26-22-25(31)23-29(33-26)24-14-7-4-8-15-24/h5-6,9-12,17-20,22,24,29H,4,7-8,13-16,21,23H2,1-3H3 |
| InChIKey | OFDCGWKUCSDIJB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|