C37H48O2Si — CID 71545551
tert-butyl-[(2Z)-2-[(2R,6R)-2-cyclohexyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane (PubChem CID 71545551) has the molecular formula C37H48O2Si and a molecular weight of 552.88 g/mol. Its IUPAC name is tert-butyl-[(2Z)-2-[(2R,6R)-2-cyclohexyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2Z)-2-[(2R,6R)-2-cyclohexyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71545551 |
| Molecular Formula | C37H48O2Si |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | tert-butyl-[(2Z)-2-[(2R,6R)-2-cyclohexyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC/C=C1/C[C@@H](CCc2ccccc2)O[C@@H](C2CCCCC2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H48O2Si/c1-37(2,3)40(34-20-12-6-13-21-34,35-22-14-7-15-23-35)38-27-26-31-28-33(25-24-30-16-8-4-9-17-30)39-36(29-31)32-18-10-5-11-19-32/h4,6-9,12-17,20-23,26,32-33,36H,5,10-11,18-19,24-25,27-29H2,1-3H3/b31-26-/t33-,36-/m1/s1 |
| InChIKey | PIKDEXZDMHSGEY-MIXHBFSKSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|