C35H46O2Si — CID 71545715
tert-butyl-[(2E)-2-[(2R,6R)-2-tert-butyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane (PubChem CID 71545715) has the molecular formula C35H46O2Si and a molecular weight of 526.84 g/mol. Its IUPAC name is tert-butyl-[(2E)-2-[(2R,6R)-2-tert-butyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2E)-2-[(2R,6R)-2-tert-butyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71545715 |
| Molecular Formula | C35H46O2Si |
| Molecular Weight | 526.84 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | tert-butyl-[(2E)-2-[(2R,6R)-2-tert-butyl-6-(2-phenylethyl)oxan-4-ylidene]ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[C@H]1C/C(=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C35H46O2Si/c1-34(2,3)33-27-29(26-30(37-33)23-22-28-16-10-7-11-17-28)24-25-36-38(35(4,5)6,31-18-12-8-13-19-31)32-20-14-9-15-21-32/h7-21,24,30,33H,22-23,25-27H2,1-6H3/b29-24+/t30-,33-/m1/s1 |
| InChIKey | WPJDRIDGQSTPNB-CAWYTLOUSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.84 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|