C29H36O3Si — CID 19694134
tert-butyl-[[4-[3-(1,3-dioxolan-2-yl)propyl]phenyl]methoxy]-diphenylsilane (PubChem CID 19694134) has the molecular formula C29H36O3Si and a molecular weight of 460.69 g/mol. Its IUPAC name is tert-butyl-[[4-[3-(1,3-dioxolan-2-yl)propyl]phenyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[4-[3-(1,3-dioxolan-2-yl)propyl]phenyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 19694134 |
| Molecular Formula | C29H36O3Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | tert-butyl-[[4-[3-(1,3-dioxolan-2-yl)propyl]phenyl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCc1ccc(CCCC2OCCO2)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36O3Si/c1-29(2,3)33(26-12-6-4-7-13-26,27-14-8-5-9-15-27)32-23-25-19-17-24(18-20-25)11-10-16-28-30-21-22-31-28/h4-9,12-15,17-20,28H,10-11,16,21-23H2,1-3H3 |
| InChIKey | ZLQVVEUBBDBXRZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|