C21H29NO3Si — CID 132942450
[(3R,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-3-yl]methanol (PubChem CID 132942450) has the molecular formula C21H29NO3Si and a molecular weight of 371.55 g/mol. Its IUPAC name is [(3R,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-3-yl]methanol.
| Compound Name | [(3R,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-3-yl]methanol |
|---|---|
| PubChem CID | 132942450 |
| Molecular Formula | C21H29NO3Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [(3R,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-3-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1CON[C@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO3Si/c1-21(2,3)26(18-10-6-4-7-11-18,19-12-8-5-9-13-19)25-16-17-15-24-22-20(17)14-23/h4-13,17,20,22-23H,14-16H2,1-3H3/t17-,20+/m1/s1 |
| InChIKey | JABHXYGCYYBKJV-XLIONFOSSA-N |
| XLogP | 2.07 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|