C32H41BrO3Si — CID 134934680
1-[(2R,4R,6S)-4-bromo-6-(2-phenylethyl)oxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxypropan-2-ol (PubChem CID 134934680) has the molecular formula C32H41BrO3Si and a molecular weight of 581.67 g/mol. Its IUPAC name is 1-[(2R,4R,6S)-4-bromo-6-(2-phenylethyl)oxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxypropan-2-ol.
| Compound Name | 1-[(2R,4R,6S)-4-bromo-6-(2-phenylethyl)oxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 134934680 |
| Molecular Formula | C32H41BrO3Si |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 1-[(2R,4R,6S)-4-bromo-6-(2-phenylethyl)oxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxypropan-2-ol |
| SMILES | CC(O)(C[C@@H]1C[C@H](Br)C[C@H](CCc2ccccc2)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H41BrO3Si/c1-31(2,3)37(29-16-10-6-11-17-29,30-18-12-7-13-19-30)36-32(4,34)24-28-23-26(33)22-27(35-28)21-20-25-14-8-5-9-15-25/h5-19,26-28,34H,20-24H2,1-4H3/t26-,27+,28+,32?/m1/s1 |
| InChIKey | VDRLVHVEFPMAMS-NUWSYRDHSA-N |
| XLogP | 6.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|