C35H42O5Si — CID 101470888
[(2R,4aS,6R,7R,9Z,11aS)-6-ethenyl-2-(4-methoxyphenyl)-4a,6,7,8,11,11a-hexahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 101470888) has the molecular formula C35H42O5Si and a molecular weight of 570.80 g/mol. Its IUPAC name is [(2R,4aS,6R,7R,9Z,11aS)-6-ethenyl-2-(4-methoxyphenyl)-4a,6,7,8,11,11a-hexahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,4aS,6R,7R,9Z,11aS)-6-ethenyl-2-(4-methoxyphenyl)-4a,6,7,8,11,11a-hexahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101470888 |
| Molecular Formula | C35H42O5Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | [(2R,4aS,6R,7R,9Z,11aS)-6-ethenyl-2-(4-methoxyphenyl)-4a,6,7,8,11,11a-hexahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C=C[C@H]1O[C@H]2CO[C@@H](c3ccc(OC)cc3)O[C@H]2C/C=C\C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H42O5Si/c1-6-30-32(40-41(35(2,3)4,28-15-9-7-10-16-28)29-17-11-8-12-18-29)20-14-13-19-31-33(38-30)25-37-34(39-31)26-21-23-27(36-5)24-22-26/h6-18,21-24,30-34H,1,19-20,25H2,2-5H3/b14-13-/t30-,31+,32-,33+,34-/m1/s1 |
| InChIKey | WDNMZFTWLIMASC-DGJKCRQASA-N |
| XLogP | 6.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|