C19H26O6 — CID 11428059
tert-butyl 2-[[(2R,4S,5R)-4-ethenyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]oxy]acetate (PubChem CID 11428059) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is tert-butyl 2-[[(2R,4S,5R)-4-ethenyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]oxy]acetate.
| Compound Name | tert-butyl 2-[[(2R,4S,5R)-4-ethenyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 11428059 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | tert-butyl 2-[[(2R,4S,5R)-4-ethenyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]oxy]acetate |
| SMILES | C=C[C@@H]1O[C@H](c2ccc(OC)cc2)OC[C@H]1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26O6/c1-6-15-16(22-12-17(20)25-19(2,3)4)11-23-18(24-15)13-7-9-14(21-5)10-8-13/h6-10,15-16,18H,1,11-12H2,2-5H3/t15-,16+,18+/m0/s1 |
| InChIKey | OFMIVVSSVUOBRQ-LZLYRXPVSA-N |
| XLogP | 3.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|