C15H22O5 — CID 71146249
[(2R,4R,5R)-2-(4-methoxyphenyl)-5-propoxy-1,3-dioxan-4-yl]methanol (PubChem CID 71146249) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is [(2R,4R,5R)-2-(4-methoxyphenyl)-5-propoxy-1,3-dioxan-4-yl]methanol.
| Compound Name | [(2R,4R,5R)-2-(4-methoxyphenyl)-5-propoxy-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 71146249 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(2R,4R,5R)-2-(4-methoxyphenyl)-5-propoxy-1,3-dioxan-4-yl]methanol |
| SMILES | CCCO[C@@H]1CO[C@@H](c2ccc(OC)cc2)O[C@@H]1CO |
| InChI | InChI=1S/C15H22O5/c1-3-8-18-14-10-19-15(20-13(14)9-16)11-4-6-12(17-2)7-5-11/h4-7,13-16H,3,8-10H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | WWDLHPOZUGEZID-RBSFLKMASA-N |
| XLogP | 1.90 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |