C19H26O5 — CID 101354260
(2R)-2-[[(2R,4S,5R)-2-(4-methoxyphenyl)-4-prop-2-enyl-1,3-dioxan-5-yl]oxy]pent-4-en-1-ol (PubChem CID 101354260) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2R)-2-[[(2R,4S,5R)-2-(4-methoxyphenyl)-4-prop-2-enyl-1,3-dioxan-5-yl]oxy]pent-4-en-1-ol.
| Compound Name | (2R)-2-[[(2R,4S,5R)-2-(4-methoxyphenyl)-4-prop-2-enyl-1,3-dioxan-5-yl]oxy]pent-4-en-1-ol |
|---|---|
| PubChem CID | 101354260 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2R)-2-[[(2R,4S,5R)-2-(4-methoxyphenyl)-4-prop-2-enyl-1,3-dioxan-5-yl]oxy]pent-4-en-1-ol |
| SMILES | C=CC[C@H](CO)O[C@@H]1CO[C@@H](c2ccc(OC)cc2)O[C@H]1CC=C |
| InChI | InChI=1S/C19H26O5/c1-4-6-16(12-20)23-18-13-22-19(24-17(18)7-5-2)14-8-10-15(21-3)11-9-14/h4-5,8-11,16-20H,1-2,6-7,12-13H2,3H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | YGVKITXYHCACNT-FCGDIQPGSA-N |
| XLogP | 3.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|