C25H34O6 — CID 102524166
(2S)-2-[(E)-2-[(4R,5S)-5-[(2R)-2-(methoxymethoxy)pent-4-enyl]-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]ethenyl]-4-methyl-3,6-dihydro-2H-pyran (PubChem CID 102524166) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (2S)-2-[(E)-2-[(4R,5S)-5-[(2R)-2-(methoxymethoxy)pent-4-enyl]-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]ethenyl]-4-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S)-2-[(E)-2-[(4R,5S)-5-[(2R)-2-(methoxymethoxy)pent-4-enyl]-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]ethenyl]-4-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102524166 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2S)-2-[(E)-2-[(4R,5S)-5-[(2R)-2-(methoxymethoxy)pent-4-enyl]-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]ethenyl]-4-methyl-3,6-dihydro-2H-pyran |
| SMILES | C=CC[C@H](C[C@@H]1OC(c2ccc(OC)cc2)O[C@@H]1/C=C/[C@@H]1CC(C)=CCO1)OCOC |
| InChI | InChI=1S/C25H34O6/c1-5-6-21(29-17-26-3)16-24-23(12-11-22-15-18(2)13-14-28-22)30-25(31-24)19-7-9-20(27-4)10-8-19/h5,7-13,21-25H,1,6,14-17H2,2-4H3/b12-11+/t21-,22-,23-,24+,25?/m1/s1 |
| InChIKey | ODUOOWXRIRGHBN-HQLLLSGLSA-N |
| XLogP | 4.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|